C14H17Cl2NO5S — CID 90027017
[3-(2,6-dichlorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate (PubChem CID 90027017) has the molecular formula C14H17Cl2NO5S and a molecular weight of 382.27 g/mol. Its IUPAC name is [3-(2,6-dichlorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate.
| Compound Name | [3-(2,6-dichlorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 90027017 |
| Molecular Formula | C14H17Cl2NO5S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | [3-(2,6-dichlorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OCC1OC2(CCCC2)OC1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H17Cl2NO5S/c15-9-4-3-5-10(16)12(9)13-11(8-20-23(17,18)19)21-14(22-13)6-1-2-7-14/h3-5,11,13H,1-2,6-8H2,(H2,17,18,19) |
| InChIKey | XRSOPXCSISXFET-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |