C15H20ClNO5S — CID 90026864
2-[3-(2-chlorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]ethyl sulfamate (PubChem CID 90026864) has the molecular formula C15H20ClNO5S and a molecular weight of 361.85 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]ethyl sulfamate.
| Compound Name | 2-[3-(2-chlorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]ethyl sulfamate |
|---|---|
| PubChem CID | 90026864 |
| Molecular Formula | C15H20ClNO5S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]ethyl sulfamate |
| SMILES | NS(=O)(=O)OCCC1OC2(CCCC2)OC1c1ccccc1Cl |
| InChI | InChI=1S/C15H20ClNO5S/c16-12-6-2-1-5-11(12)14-13(7-10-20-23(17,18)19)21-15(22-14)8-3-4-9-15/h1-2,5-6,13-14H,3-4,7-10H2,(H2,17,18,19) |
| InChIKey | IDCRWWJQMDMCQE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |