C15H22ClNO5S — CID 118379152
2-[(4S,5S)-5-(2-chlorophenyl)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl sulfamate (PubChem CID 118379152) has the molecular formula C15H22ClNO5S and a molecular weight of 363.86 g/mol. Its IUPAC name is 2-[(4S,5S)-5-(2-chlorophenyl)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl sulfamate.
| Compound Name | 2-[(4S,5S)-5-(2-chlorophenyl)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl sulfamate |
|---|---|
| PubChem CID | 118379152 |
| Molecular Formula | C15H22ClNO5S |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[(4S,5S)-5-(2-chlorophenyl)-2,2-diethyl-1,3-dioxolan-4-yl]ethyl sulfamate |
| SMILES | CCC1(CC)O[C@@H](CCOS(N)(=O)=O)[C@H](c2ccccc2Cl)O1 |
| InChI | InChI=1S/C15H22ClNO5S/c1-3-15(4-2)21-13(9-10-20-23(17,18)19)14(22-15)11-7-5-6-8-12(11)16/h5-8,13-14H,3-4,9-10H2,1-2H3,(H2,17,18,19)/t13-,14-/m0/s1 |
| InChIKey | IQUJYITYUVTFDO-KBPBESRZSA-N |
| XLogP | 2.92 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |