C14H22N2O5S — CID 90026561
[5-(2-aminophenyl)-2,2-diethyl-1,3-dioxolan-4-yl]methyl sulfamate (PubChem CID 90026561) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is [5-(2-aminophenyl)-2,2-diethyl-1,3-dioxolan-4-yl]methyl sulfamate.
| Compound Name | [5-(2-aminophenyl)-2,2-diethyl-1,3-dioxolan-4-yl]methyl sulfamate |
|---|---|
| PubChem CID | 90026561 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [5-(2-aminophenyl)-2,2-diethyl-1,3-dioxolan-4-yl]methyl sulfamate |
| SMILES | CCC1(CC)OC(COS(N)(=O)=O)C(c2ccccc2N)O1 |
| InChI | InChI=1S/C14H22N2O5S/c1-3-14(4-2)20-12(9-19-22(16,17)18)13(21-14)10-7-5-6-8-11(10)15/h5-8,12-13H,3-4,9,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | MOUITVGTOGQRGR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|