C15H23NO5S — CID 129068508
(5-benzyl-2,2-diethyl-1,3-dioxolan-4-yl)-methylsulfamic acid (PubChem CID 129068508) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is (5-benzyl-2,2-diethyl-1,3-dioxolan-4-yl)-methylsulfamic acid.
| Compound Name | (5-benzyl-2,2-diethyl-1,3-dioxolan-4-yl)-methylsulfamic acid |
|---|---|
| PubChem CID | 129068508 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (5-benzyl-2,2-diethyl-1,3-dioxolan-4-yl)-methylsulfamic acid |
| SMILES | CCC1(CC)OC(Cc2ccccc2)C(N(C)S(=O)(=O)O)O1 |
| InChI | InChI=1S/C15H23NO5S/c1-4-15(5-2)20-13(11-12-9-7-6-8-10-12)14(21-15)16(3)22(17,18)19/h6-10,13-14H,4-5,11H2,1-3H3,(H,17,18,19) |
| InChIKey | OQLPUDLFGXURSL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|