About fluoromethane;methyl(2-phenylethyl)sulfamic acid
fluoromethane;methyl(2-phenylethyl)sulfamic acid (PubChem CID 154691947) has the molecular formula C10H16FNO3S
and a molecular weight of 249.31 g/mol. Its IUPAC name is fluoromethane;methyl(2-phenylethyl)sulfamic acid.
Molecular Properties
| Compound Name | fluoromethane;methyl(2-phenylethyl)sulfamic acid |
| PubChem CID | 154691947 |
| Molecular Formula | C10H16FNO3S |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | fluoromethane;methyl(2-phenylethyl)sulfamic acid |
| SMILES | CF.CN(CCc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C9H13NO3S.CH3F/c1-10(14(11,12)13)8-7-9-5-3-2-4-6-9;1-2/h2-6H,7-8H2,1H3,(H,11,12,13);1H3 |
| InChIKey | XGGSKEZWQMJLRA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze fluoromethane;methyl(2-phenylethyl)sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;methyl(2-phenylethyl)sulfamic acid?
The IUPAC name of fluoromethane;methyl(2-phenylethyl)sulfamic acid (CID 154691947) is fluoromethane;methyl(2-phenylethyl)sulfamic acid.
What is the SMILES notation for fluoromethane;methyl(2-phenylethyl)sulfamic acid?
The canonical SMILES for fluoromethane;methyl(2-phenylethyl)sulfamic acid is CF.CN(CCc1ccccc1)S(=O)(=O)O.
What is the InChIKey of fluoromethane;methyl(2-phenylethyl)sulfamic acid?
The InChIKey is XGGSKEZWQMJLRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S.CH3F/c1-10(14(11,12)13)8-7-9-5-3-2-4-6-9;1-2/h2-6H,7-8H2,1H3,(H,11,12,13);1H3.
What are the key properties of fluoromethane;methyl(2-phenylethyl)sulfamic acid?
fluoromethane;methyl(2-phenylethyl)sulfamic acid has a molecular weight of 249.31 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;methyl(2-phenylethyl)sulfamic acid is sourced from PubChem (CID 154691947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).