fluoromethane;methyl(2-phenylethyl)sulfamic acid

C10H16FNO3S — CID 154691947

IUPACfluoromethane;methyl(2-phenylethyl)sulfamic acid
SMILESCF.CN(CCc1ccccc1)S(=O)(=O)O
InChIInChI=1S/C9H13NO3S.CH3F/c1-10(14(11,12)13)8-7-9-5-3-2-4-6-9;1-2/h2-6H,7-8H2,1H3,(H,11,12,13);1H3
InChIKeyXGGSKEZWQMJLRA-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.55
Rot. Bonds4

About fluoromethane;methyl(2-phenylethyl)sulfamic acid

fluoromethane;methyl(2-phenylethyl)sulfamic acid (PubChem CID 154691947) has the molecular formula C10H16FNO3S and a molecular weight of 249.31 g/mol. Its IUPAC name is fluoromethane;methyl(2-phenylethyl)sulfamic acid.

Molecular Properties

Compound Namefluoromethane;methyl(2-phenylethyl)sulfamic acid
PubChem CID154691947
Molecular FormulaC10H16FNO3S
Molecular Weight249.31 g/mol
Exact Mass249.08
IUPAC Namefluoromethane;methyl(2-phenylethyl)sulfamic acid
SMILESCF.CN(CCc1ccccc1)S(=O)(=O)O
InChIInChI=1S/C9H13NO3S.CH3F/c1-10(14(11,12)13)8-7-9-5-3-2-4-6-9;1-2/h2-6H,7-8H2,1H3,(H,11,12,13);1H3
InChIKeyXGGSKEZWQMJLRA-UHFFFAOYSA-N
XLogP1.55
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze fluoromethane;methyl(2-phenylethyl)sulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoromethane;methyl(2-phenylethyl)sulfamic acid?
The IUPAC name of fluoromethane;methyl(2-phenylethyl)sulfamic acid (CID 154691947) is fluoromethane;methyl(2-phenylethyl)sulfamic acid.
What is the SMILES notation for fluoromethane;methyl(2-phenylethyl)sulfamic acid?
The canonical SMILES for fluoromethane;methyl(2-phenylethyl)sulfamic acid is CF.CN(CCc1ccccc1)S(=O)(=O)O.
What is the InChIKey of fluoromethane;methyl(2-phenylethyl)sulfamic acid?
The InChIKey is XGGSKEZWQMJLRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S.CH3F/c1-10(14(11,12)13)8-7-9-5-3-2-4-6-9;1-2/h2-6H,7-8H2,1H3,(H,11,12,13);1H3.
What are the key properties of fluoromethane;methyl(2-phenylethyl)sulfamic acid?
fluoromethane;methyl(2-phenylethyl)sulfamic acid has a molecular weight of 249.31 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;methyl(2-phenylethyl)sulfamic acid is sourced from PubChem (CID 154691947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).