C14H20FNO5S — CID 129068419
[2,2-diethyl-5-(2-fluorophenyl)-1,3-dioxolan-4-yl]-methylsulfamic acid (PubChem CID 129068419) has the molecular formula C14H20FNO5S and a molecular weight of 333.38 g/mol. Its IUPAC name is [2,2-diethyl-5-(2-fluorophenyl)-1,3-dioxolan-4-yl]-methylsulfamic acid.
| Compound Name | [2,2-diethyl-5-(2-fluorophenyl)-1,3-dioxolan-4-yl]-methylsulfamic acid |
|---|---|
| PubChem CID | 129068419 |
| Molecular Formula | C14H20FNO5S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [2,2-diethyl-5-(2-fluorophenyl)-1,3-dioxolan-4-yl]-methylsulfamic acid |
| SMILES | CCC1(CC)OC(c2ccccc2F)C(N(C)S(=O)(=O)O)O1 |
| InChI | InChI=1S/C14H20FNO5S/c1-4-14(5-2)20-12(10-8-6-7-9-11(10)15)13(21-14)16(3)22(17,18)19/h6-9,12-13H,4-5H2,1-3H3,(H,17,18,19) |
| InChIKey | HELQQTBJABLIJH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|