C16H16FNO5S — CID 135383298
[(4R,5R)-5-(2-fluorophenyl)-2-phenyl-1,3-dioxolan-4-yl]methylsulfamic acid (PubChem CID 135383298) has the molecular formula C16H16FNO5S and a molecular weight of 353.37 g/mol. Its IUPAC name is [(4R,5R)-5-(2-fluorophenyl)-2-phenyl-1,3-dioxolan-4-yl]methylsulfamic acid.
| Compound Name | [(4R,5R)-5-(2-fluorophenyl)-2-phenyl-1,3-dioxolan-4-yl]methylsulfamic acid |
|---|---|
| PubChem CID | 135383298 |
| Molecular Formula | C16H16FNO5S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [(4R,5R)-5-(2-fluorophenyl)-2-phenyl-1,3-dioxolan-4-yl]methylsulfamic acid |
| SMILES | O=S(=O)(O)NC[C@H]1OC(c2ccccc2)O[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C16H16FNO5S/c17-13-9-5-4-8-12(13)15-14(10-18-24(19,20)21)22-16(23-15)11-6-2-1-3-7-11/h1-9,14-16,18H,10H2,(H,19,20,21)/t14-,15-,16?/m1/s1 |
| InChIKey | YVNDTKXCQNAUGD-YGFGXBMJSA-N |
| XLogP | 2.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|