C11H16N2O5S — CID 129068489
[5-(2-aminophenyl)-2-methyl-1,3-dioxolan-4-yl]-methylsulfamic acid (PubChem CID 129068489) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is [5-(2-aminophenyl)-2-methyl-1,3-dioxolan-4-yl]-methylsulfamic acid.
| Compound Name | [5-(2-aminophenyl)-2-methyl-1,3-dioxolan-4-yl]-methylsulfamic acid |
|---|---|
| PubChem CID | 129068489 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [5-(2-aminophenyl)-2-methyl-1,3-dioxolan-4-yl]-methylsulfamic acid |
| SMILES | CC1OC(c2ccccc2N)C(N(C)S(=O)(=O)O)O1 |
| InChI | InChI=1S/C11H16N2O5S/c1-7-17-10(8-5-3-4-6-9(8)12)11(18-7)13(2)19(14,15)16/h3-7,10-11H,12H2,1-2H3,(H,14,15,16) |
| InChIKey | INYWQKJXNUGBMS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|