C12H18N2O5S — CID 175002719
methyl N-[5-(2-aminophenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]sulfamate (PubChem CID 175002719) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is methyl N-[5-(2-aminophenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]sulfamate.
| Compound Name | methyl N-[5-(2-aminophenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]sulfamate |
|---|---|
| PubChem CID | 175002719 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | methyl N-[5-(2-aminophenyl)-2,2-dimethyl-1,3-dioxolan-4-yl]sulfamate |
| SMILES | COS(=O)(=O)NC1OC(C)(C)OC1c1ccccc1N |
| InChI | InChI=1S/C12H18N2O5S/c1-12(2)18-10(8-6-4-5-7-9(8)13)11(19-12)14-20(15,16)17-3/h4-7,10-11,14H,13H2,1-3H3 |
| InChIKey | MRCFHVXETYSXLA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|