C19H22N4O4 — CID 11079170
(4R,5R)-4-N,5-N-bis(2-aminophenyl)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 11079170) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is (4R,5R)-4-N,5-N-bis(2-aminophenyl)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | (4R,5R)-4-N,5-N-bis(2-aminophenyl)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 11079170 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (4R,5R)-4-N,5-N-bis(2-aminophenyl)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | CC1(C)O[C@@H](C(=O)Nc2ccccc2N)[C@H](C(=O)Nc2ccccc2N)O1 |
| InChI | InChI=1S/C19H22N4O4/c1-19(2)26-15(17(24)22-13-9-5-3-7-11(13)20)16(27-19)18(25)23-14-10-6-4-8-12(14)21/h3-10,15-16H,20-21H2,1-2H3,(H,22,24)(H,23,25)/t15-,16-/m1/s1 |
| InChIKey | ZZSTVLWVKFFXJJ-HZPDHXFCSA-N |
| XLogP | 1.95 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|