C18H27N3O4 — CID 19893675
N-[3-(2-aminoanilino)-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide (PubChem CID 19893675) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[3-(2-aminoanilino)-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide.
| Compound Name | N-[3-(2-aminoanilino)-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide |
|---|---|
| PubChem CID | 19893675 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-[3-(2-aminoanilino)-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide |
| SMILES | CC1(C)OCC(C)(C)C(C(=O)NCCC(=O)Nc2ccccc2N)O1 |
| InChI | InChI=1S/C18H27N3O4/c1-17(2)11-24-18(3,4)25-15(17)16(23)20-10-9-14(22)21-13-8-6-5-7-12(13)19/h5-8,15H,9-11,19H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | NSCSGEZLCBITJQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|