C33H60N2O6 — CID 139688886
2-[[(Z)-octadec-9-enoyl]amino]propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 139688886) has the molecular formula C33H60N2O6 and a molecular weight of 580.85 g/mol. Its IUPAC name is 2-[[(Z)-octadec-9-enoyl]amino]propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | 2-[[(Z)-octadec-9-enoyl]amino]propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 139688886 |
| Molecular Formula | C33H60N2O6 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.45 |
| IUPAC Name | 2-[[(Z)-octadec-9-enoyl]amino]propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(C)COC(=O)CCNC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C33H60N2O6/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(36)35-27(2)25-39-29(37)23-24-34-31(38)30-32(3,4)26-40-33(5,6)41-30/h14-15,27,30H,7-13,16-26H2,1-6H3,(H,34,38)(H,35,36)/b15-14- |
| InChIKey | QGOWKJFNXIRAAE-PFONDFGASA-N |
| XLogP | 6.76 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|