C47H87NO9 — CID 171758256
[2-(2-hexyldecanoyloxy)-3-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoyloxy]propyl] 2-hexyldecanoate (PubChem CID 171758256) has the molecular formula C47H87NO9 and a molecular weight of 810.21 g/mol. Its IUPAC name is [2-(2-hexyldecanoyloxy)-3-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoyloxy]propyl] 2-hexyldecanoate.
| Compound Name | [2-(2-hexyldecanoyloxy)-3-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoyloxy]propyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 171758256 |
| Molecular Formula | C47H87NO9 |
| Molecular Weight | 810.21 g/mol |
| Exact Mass | 809.64 |
| IUPAC Name | [2-(2-hexyldecanoyloxy)-3-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoyloxy]propyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCC(COC(=O)CCNC(=O)[C@@H]1OC(C)(C)OCC1(C)C)OC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C47H87NO9/c1-9-13-17-21-23-27-30-38(29-25-19-15-11-3)44(51)54-36-40(56-45(52)39(31-26-20-16-12-4)32-28-24-22-18-14-10-2)35-53-41(49)33-34-48-43(50)42-46(5,6)37-55-47(7,8)57-42/h38-40,42H,9-37H2,1-8H3,(H,48,50)/t38?,39?,40?,42-/m0/s1 |
| InChIKey | CQZCGOMXRTUHMY-JRLAMPGQSA-N |
| XLogP | 11.34 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.21 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|