C38H64N3O6- — CID 19893472
2-[1-[carbamoyl-[(9E,12E,15E)-nonadeca-9,12,15-trien-2-yl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 19893472) has the molecular formula C38H64N3O6- and a molecular weight of 658.95 g/mol. Its IUPAC name is 2-[1-[carbamoyl-[(9E,12E,15E)-nonadeca-9,12,15-trien-2-yl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | 2-[1-[carbamoyl-[(9E,12E,15E)-nonadeca-9,12,15-trien-2-yl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 19893472 |
| Molecular Formula | C38H64N3O6- |
| Molecular Weight | 658.95 g/mol |
| Exact Mass | 658.48 |
| IUPAC Name | 2-[1-[carbamoyl-[(9E,12E,15E)-nonadeca-9,12,15-trien-2-yl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCC/C=C/C/C=C/C/C=C/CCCCCCC(C)N(C(N)=O)C1(C(CNC(=O)C2OC(C)(C)OCC2(C)C)C(=O)[O-])CCCCC1 |
| InChI | InChI=1S/C38H65N3O6/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-25-30(2)41(35(39)45)38(26-23-21-24-27-38)31(34(43)44)28-40-33(42)32-36(3,4)29-46-37(5,6)47-32/h9-10,12-13,15-16,30-32H,7-8,11,14,17-29H2,1-6H3,(H2,39,45)(H,40,42)(H,43,44)/p-1/b10-9+,13-12+,16-15+ |
| InChIKey | IMGWCVOCBKQIDH-WYTUUNCASA-M |
| XLogP | 6.71 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.95 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|