C37H65N3O6 — CID 57160775
3-[2-[carbamoyl(octadeca-8,11-dienyl)amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid (PubChem CID 57160775) has the molecular formula C37H65N3O6 and a molecular weight of 647.94 g/mol. Its IUPAC name is 3-[2-[carbamoyl(octadeca-8,11-dienyl)amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid.
| Compound Name | 3-[2-[carbamoyl(octadeca-8,11-dienyl)amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 57160775 |
| Molecular Formula | C37H65N3O6 |
| Molecular Weight | 647.94 g/mol |
| Exact Mass | 647.49 |
| IUPAC Name | 3-[2-[carbamoyl(octadeca-8,11-dienyl)amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
| SMILES | CCCCCCC=CCC=CCCCCCCCN(C(N)=O)C1CCCCC1C(CC(=O)O)NC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C37H65N3O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-26-40(35(38)44)31-25-22-21-24-29(31)30(27-32(41)42)39-34(43)33-36(2,3)28-45-37(4,5)46-33/h11-12,14-15,29-31,33H,6-10,13,16-28H2,1-5H3,(H2,38,44)(H,39,43)(H,41,42) |
| InChIKey | NMZYZMRKFUAEIJ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.94 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|