C36H58N2O6 — CID 67795866
2-[4-(octadec-9-enoylamino)phenyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid (PubChem CID 67795866) has the molecular formula C36H58N2O6 and a molecular weight of 614.87 g/mol. Its IUPAC name is 2-[4-(octadec-9-enoylamino)phenyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid.
| Compound Name | 2-[4-(octadec-9-enoylamino)phenyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 67795866 |
| Molecular Formula | C36H58N2O6 |
| Molecular Weight | 614.87 g/mol |
| Exact Mass | 614.43 |
| IUPAC Name | 2-[4-(octadec-9-enoylamino)phenyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)Nc1ccc(C(CNC(=O)C2OC(C)(C)OCC2(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C36H58N2O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-31(39)38-29-24-22-28(23-25-29)30(34(41)42)26-37-33(40)32-35(2,3)27-43-36(4,5)44-32/h13-14,22-25,30,32H,6-12,15-21,26-27H2,1-5H3,(H,37,40)(H,38,39)(H,41,42) |
| InChIKey | QYRANZXKSACEHA-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.87 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|