C26H41N3O5 — CID 57144034
N-[3-amino-1-[2-(octanoylamino)phenyl]-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide (PubChem CID 57144034) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is N-[3-amino-1-[2-(octanoylamino)phenyl]-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide.
| Compound Name | N-[3-amino-1-[2-(octanoylamino)phenyl]-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide |
|---|---|
| PubChem CID | 57144034 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | N-[3-amino-1-[2-(octanoylamino)phenyl]-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide |
| SMILES | CCCCCCCC(=O)Nc1ccccc1C(CC(N)=O)NC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C26H41N3O5/c1-6-7-8-9-10-15-22(31)28-19-14-12-11-13-18(19)20(16-21(27)30)29-24(32)23-25(2,3)17-33-26(4,5)34-23/h11-14,20,23H,6-10,15-17H2,1-5H3,(H2,27,30)(H,28,31)(H,29,32) |
| InChIKey | KIXSGSFLPSYOIH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|