C36H66N2O6 — CID 67795704
[4-methyl-2-(octadec-9-enoylamino)pentyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 67795704) has the molecular formula C36H66N2O6 and a molecular weight of 622.93 g/mol. Its IUPAC name is [4-methyl-2-(octadec-9-enoylamino)pentyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [4-methyl-2-(octadec-9-enoylamino)pentyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 67795704 |
| Molecular Formula | C36H66N2O6 |
| Molecular Weight | 622.93 g/mol |
| Exact Mass | 622.49 |
| IUPAC Name | [4-methyl-2-(octadec-9-enoylamino)pentyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(COC(=O)CCNC(=O)C1OC(C)(C)OCC1(C)C)CC(C)C |
| InChI | InChI=1S/C36H66N2O6/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-31(39)38-30(26-29(2)3)27-42-32(40)24-25-37-34(41)33-35(4,5)28-43-36(6,7)44-33/h15-16,29-30,33H,8-14,17-28H2,1-7H3,(H,37,41)(H,38,39) |
| InChIKey | STDKXFCSLFBLNU-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.93 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|