C35H62N2O6 — CID 67795577
[2-[[(Z)-octadec-9-enoyl]amino]cyclopentyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 67795577) has the molecular formula C35H62N2O6 and a molecular weight of 606.89 g/mol. Its IUPAC name is [2-[[(Z)-octadec-9-enoyl]amino]cyclopentyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [2-[[(Z)-octadec-9-enoyl]amino]cyclopentyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 67795577 |
| Molecular Formula | C35H62N2O6 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.46 |
| IUPAC Name | [2-[[(Z)-octadec-9-enoyl]amino]cyclopentyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC1CCCC1OC(=O)CCNC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C35H62N2O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-30(38)37-28-22-21-23-29(28)42-31(39)25-26-36-33(40)32-34(2,3)27-41-35(4,5)43-32/h13-14,28-29,32H,6-12,15-27H2,1-5H3,(H,36,40)(H,37,38)/b14-13- |
| InChIKey | GUQXEGLZVDHOGV-YPKPFQOOSA-N |
| XLogP | 7.29 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|