C32H57N3O6 — CID 19893435
[2-[(1-hexylcyclohexyl)carbamoylamino]cycloheptyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 19893435) has the molecular formula C32H57N3O6 and a molecular weight of 579.82 g/mol. Its IUPAC name is [2-[(1-hexylcyclohexyl)carbamoylamino]cycloheptyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [2-[(1-hexylcyclohexyl)carbamoylamino]cycloheptyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 19893435 |
| Molecular Formula | C32H57N3O6 |
| Molecular Weight | 579.82 g/mol |
| Exact Mass | 579.42 |
| IUPAC Name | [2-[(1-hexylcyclohexyl)carbamoylamino]cycloheptyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCC1(NC(=O)NC2CCCCCC2OC(=O)CCNC(=O)C2OC(C)(C)OCC2(C)C)CCCCC1 |
| InChI | InChI=1S/C32H57N3O6/c1-6-7-8-13-19-32(20-14-10-15-21-32)35-29(38)34-24-16-11-9-12-17-25(24)40-26(36)18-22-33-28(37)27-30(2,3)23-39-31(4,5)41-27/h24-25,27H,6-23H2,1-5H3,(H,33,37)(H2,34,35,38) |
| InChIKey | RHWNLVCEPSTOAC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|