C31H55N3O6 — CID 54338798
[2-[[cyclohexyl(hexyl)carbamoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 54338798) has the molecular formula C31H55N3O6 and a molecular weight of 565.80 g/mol. Its IUPAC name is [2-[[cyclohexyl(hexyl)carbamoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [2-[[cyclohexyl(hexyl)carbamoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 54338798 |
| Molecular Formula | C31H55N3O6 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.41 |
| IUPAC Name | [2-[[cyclohexyl(hexyl)carbamoyl]amino]cyclohexyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCN(C(=O)NC1CCCCC1OC(=O)CCNC(=O)C1OC(C)(C)OCC1(C)C)C1CCCCC1 |
| InChI | InChI=1S/C31H55N3O6/c1-6-7-8-14-21-34(23-15-10-9-11-16-23)29(37)33-24-17-12-13-18-25(24)39-26(35)19-20-32-28(36)27-30(2,3)22-38-31(4,5)40-27/h23-25,27H,6-22H2,1-5H3,(H,32,36)(H,33,37) |
| InChIKey | TXLIUAVLRZOKER-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|