C33H60N3O6- — CID 19893653
2-[1-[hexyl(octylcarbamoyl)amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 19893653) has the molecular formula C33H60N3O6- and a molecular weight of 594.86 g/mol. Its IUPAC name is 2-[1-[hexyl(octylcarbamoyl)amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | 2-[1-[hexyl(octylcarbamoyl)amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 19893653 |
| Molecular Formula | C33H60N3O6- |
| Molecular Weight | 594.86 g/mol |
| Exact Mass | 594.45 |
| IUPAC Name | 2-[1-[hexyl(octylcarbamoyl)amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCCNC(=O)N(CCCCCC)C1(C(CNC(=O)C2OC(C)(C)OCC2(C)C)C(=O)[O-])CCCCC1 |
| InChI | InChI=1S/C33H61N3O6/c1-7-9-11-13-14-18-22-34-30(40)36(23-19-12-10-8-2)33(20-16-15-17-21-33)26(29(38)39)24-35-28(37)27-31(3,4)25-41-32(5,6)42-27/h26-27H,7-25H2,1-6H3,(H,34,40)(H,35,37)(H,38,39)/p-1 |
| InChIKey | ZFGRVYFROIOWAF-UHFFFAOYSA-M |
| XLogP | 5.30 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|