C40H71N3O6 — CID 19893897
2-[1-[carbamoyl-[1-[(E)-hexadec-6-enyl]cyclopentyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid (PubChem CID 19893897) has the molecular formula C40H71N3O6 and a molecular weight of 690.02 g/mol. Its IUPAC name is 2-[1-[carbamoyl-[1-[(E)-hexadec-6-enyl]cyclopentyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid.
| Compound Name | 2-[1-[carbamoyl-[1-[(E)-hexadec-6-enyl]cyclopentyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 19893897 |
| Molecular Formula | C40H71N3O6 |
| Molecular Weight | 690.02 g/mol |
| Exact Mass | 689.53 |
| IUPAC Name | 2-[1-[carbamoyl-[1-[(E)-hexadec-6-enyl]cyclopentyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
| SMILES | CCCCCCCCC/C=C/CCCCCC1(N(C(N)=O)C2(C(CNC(=O)C3OC(C)(C)OCC3(C)C)C(=O)O)CCCCC2)CCCC1 |
| InChI | InChI=1S/C40H71N3O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-20-25-39(26-23-24-27-39)43(36(41)47)40(28-21-19-22-29-40)32(35(45)46)30-42-34(44)33-37(2,3)31-48-38(4,5)49-33/h14-15,32-33H,6-13,16-31H2,1-5H3,(H2,41,47)(H,42,44)(H,45,46)/b15-14+ |
| InChIKey | YRIQLGPSGDIRLR-CCEZHUSRSA-N |
| XLogP | 9.02 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.02 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|