C35H64N2O6 — CID 67795999
7-(octadec-9-enoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]heptanoic acid (PubChem CID 67795999) has the molecular formula C35H64N2O6 and a molecular weight of 608.91 g/mol. Its IUPAC name is 7-(octadec-9-enoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]heptanoic acid.
| Compound Name | 7-(octadec-9-enoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]heptanoic acid |
|---|---|
| PubChem CID | 67795999 |
| Molecular Formula | C35H64N2O6 |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 608.48 |
| IUPAC Name | 7-(octadec-9-enoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]heptanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCCCCC(CNC(=O)C1OC(C)(C)OCC1(C)C)C(=O)O |
| InChI | InChI=1S/C35H64N2O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-25-30(38)36-26-23-20-21-24-29(33(40)41)27-37-32(39)31-34(2,3)28-42-35(4,5)43-31/h13-14,29,31H,6-12,15-28H2,1-5H3,(H,36,38)(H,37,39)(H,40,41) |
| InChIKey | SFZWRNSFIBIJDC-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|