C32H58N2O6 — CID 67794379
5-(2,2-dimethylpentadec-11-enoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]pentanoic acid (PubChem CID 67794379) has the molecular formula C32H58N2O6 and a molecular weight of 566.82 g/mol. Its IUPAC name is 5-(2,2-dimethylpentadec-11-enoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 5-(2,2-dimethylpentadec-11-enoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 67794379 |
| Molecular Formula | C32H58N2O6 |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.43 |
| IUPAC Name | 5-(2,2-dimethylpentadec-11-enoylamino)-2-[[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCCC=CCCCCCCCCC(C)(C)C(=O)NCCCC(CNC(=O)C1OC(C)(C)OCC1(C)C)C(=O)O |
| InChI | InChI=1S/C32H58N2O6/c1-8-9-10-11-12-13-14-15-16-17-18-21-30(2,3)29(38)33-22-19-20-25(28(36)37)23-34-27(35)26-31(4,5)24-39-32(6,7)40-26/h10-11,25-26H,8-9,12-24H2,1-7H3,(H,33,38)(H,34,35)(H,36,37) |
| InChIKey | OOCUQNNJFUHLKY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|