C28H52N2O6 — CID 57150190
5-(2,2-dimethylundecanoylamino)-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]hexanoic acid (PubChem CID 57150190) has the molecular formula C28H52N2O6 and a molecular weight of 512.73 g/mol. Its IUPAC name is 5-(2,2-dimethylundecanoylamino)-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]hexanoic acid.
| Compound Name | 5-(2,2-dimethylundecanoylamino)-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 57150190 |
| Molecular Formula | C28H52N2O6 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.38 |
| IUPAC Name | 5-(2,2-dimethylundecanoylamino)-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]hexanoic acid |
| SMILES | CCCCCCCCCC(C)(C)C(=O)NC(C)CC(CC(=O)O)NC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C28H52N2O6/c1-9-10-11-12-13-14-15-16-26(3,4)25(34)29-20(2)17-21(18-22(31)32)30-24(33)23-27(5,6)19-35-28(7,8)36-23/h20-21,23H,9-19H2,1-8H3,(H,29,34)(H,30,33)(H,31,32) |
| InChIKey | OZRDDBDLMGXLME-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|