C34H63N3O6 — CID 57094113
3-[2-[[hexyl(octyl)carbamoyl]amino]cycloheptyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid (PubChem CID 57094113) has the molecular formula C34H63N3O6 and a molecular weight of 609.89 g/mol. Its IUPAC name is 3-[2-[[hexyl(octyl)carbamoyl]amino]cycloheptyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid.
| Compound Name | 3-[2-[[hexyl(octyl)carbamoyl]amino]cycloheptyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 57094113 |
| Molecular Formula | C34H63N3O6 |
| Molecular Weight | 609.89 g/mol |
| Exact Mass | 609.47 |
| IUPAC Name | 3-[2-[[hexyl(octyl)carbamoyl]amino]cycloheptyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
| SMILES | CCCCCCCCN(CCCCCC)C(=O)NC1CCCCCC1C(CC(=O)O)NC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C34H63N3O6/c1-7-9-11-13-14-19-23-37(22-18-12-10-8-2)32(41)36-27-21-17-15-16-20-26(27)28(24-29(38)39)35-31(40)30-33(3,4)25-42-34(5,6)43-30/h26-28,30H,7-25H2,1-6H3,(H,35,40)(H,36,41)(H,38,39) |
| InChIKey | IYIDLMDIAWVHNJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.89 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|