C32H46N2O6 — CID 57185780
3-[2-[[1-(3-phenylprop-2-enyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid (PubChem CID 57185780) has the molecular formula C32H46N2O6 and a molecular weight of 554.73 g/mol. Its IUPAC name is 3-[2-[[1-(3-phenylprop-2-enyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid.
| Compound Name | 3-[2-[[1-(3-phenylprop-2-enyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 57185780 |
| Molecular Formula | C32H46N2O6 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | 3-[2-[[1-(3-phenylprop-2-enyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
| SMILES | CC1(C)OCC(C)(C)C(C(=O)NC(CC(=O)O)C2CCCCC2NC(=O)C2(CC=Cc3ccccc3)CCC2)O1 |
| InChI | InChI=1S/C32H46N2O6/c1-30(2)21-39-31(3,4)40-27(30)28(37)33-25(20-26(35)36)23-15-8-9-16-24(23)34-29(38)32(18-11-19-32)17-10-14-22-12-6-5-7-13-22/h5-7,10,12-14,23-25,27H,8-9,11,15-21H2,1-4H3,(H,33,37)(H,34,38)(H,35,36) |
| InChIKey | SPCGKFBWQMIUIV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |