C31H48N2O6 — CID 57176433
3-[2-[(1-butylcyclobutanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57176433) has the molecular formula C31H48N2O6 and a molecular weight of 544.73 g/mol. Its IUPAC name is 3-[2-[(1-butylcyclobutanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-[(1-butylcyclobutanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57176433 |
| Molecular Formula | C31H48N2O6 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | 3-[2-[(1-butylcyclobutanecarbonyl)amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCC1(C(=O)NC2CCCCC2C(CC(=O)O)c2[nH]ccc2C(=O)C2OC(C)(C)OCC2(C)C)CCC1 |
| InChI | InChI=1S/C31H48N2O6/c1-6-7-14-31(15-10-16-31)28(37)33-23-12-9-8-11-20(23)22(18-24(34)35)25-21(13-17-32-25)26(36)27-29(2,3)19-38-30(4,5)39-27/h13,17,20,22-23,27,32H,6-12,14-16,18-19H2,1-5H3,(H,33,37)(H,34,35) |
| InChIKey | PTDQTZDXANCCRJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |