C45H77N3O6 — CID 56988255
2-[cyclopentyl-(2-methyloctadec-9-en-2-ylcarbamoylamino)-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]methyl]hexanoic acid (PubChem CID 56988255) has the molecular formula C45H77N3O6 and a molecular weight of 756.13 g/mol. Its IUPAC name is 2-[cyclopentyl-(2-methyloctadec-9-en-2-ylcarbamoylamino)-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]methyl]hexanoic acid.
| Compound Name | 2-[cyclopentyl-(2-methyloctadec-9-en-2-ylcarbamoylamino)-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]methyl]hexanoic acid |
|---|---|
| PubChem CID | 56988255 |
| Molecular Formula | C45H77N3O6 |
| Molecular Weight | 756.13 g/mol |
| Exact Mass | 755.58 |
| IUPAC Name | 2-[cyclopentyl-(2-methyloctadec-9-en-2-ylcarbamoylamino)-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]methyl]hexanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCC(C)(C)NC(=O)NC(c1[nH]ccc1C(=O)C1OC(C)(C)OCC1(C)C)(C1CCCC1)C(CCCC)C(=O)O |
| InChI | InChI=1S/C45H77N3O6/c1-9-11-13-14-15-16-17-18-19-20-21-22-23-26-31-43(5,6)47-41(52)48-45(34-27-24-25-28-34,36(40(50)51)29-12-10-2)38-35(30-32-46-38)37(49)39-42(3,4)33-53-44(7,8)54-39/h18-19,30,32,34,36,39,46H,9-17,20-29,31,33H2,1-8H3,(H,50,51)(H2,47,48,52) |
| InChIKey | YUSWOZGWXDBAGR-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.13 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|