C43H73N3O6 — CID 57000974
2-[cyclohexyl-(hexadec-11-en-2-ylcarbamoylamino)-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]methyl]hexanoic acid (PubChem CID 57000974) has the molecular formula C43H73N3O6 and a molecular weight of 728.07 g/mol. Its IUPAC name is 2-[cyclohexyl-(hexadec-11-en-2-ylcarbamoylamino)-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]methyl]hexanoic acid.
| Compound Name | 2-[cyclohexyl-(hexadec-11-en-2-ylcarbamoylamino)-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]methyl]hexanoic acid |
|---|---|
| PubChem CID | 57000974 |
| Molecular Formula | C43H73N3O6 |
| Molecular Weight | 728.07 g/mol |
| Exact Mass | 727.55 |
| IUPAC Name | 2-[cyclohexyl-(hexadec-11-en-2-ylcarbamoylamino)-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]methyl]hexanoic acid |
| SMILES | CCCCC=CCCCCCCCCC(C)NC(=O)NC(c1[nH]ccc1C(=O)C1OC(C)(C)OCC1(C)C)(C1CCCCC1)C(CCCC)C(=O)O |
| InChI | InChI=1S/C43H73N3O6/c1-8-10-12-13-14-15-16-17-18-19-20-22-25-32(3)45-40(50)46-43(33-26-23-21-24-27-33,35(39(48)49)28-11-9-2)37-34(29-30-44-37)36(47)38-41(4,5)31-51-42(6,7)52-38/h13-14,29-30,32-33,35,38,44H,8-12,15-28,31H2,1-7H3,(H,48,49)(H2,45,46,50) |
| InChIKey | RCRVSGUJIDLOMB-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.07 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|