C32H44N2O7 — CID 57130518
3-[2-[[1-(furan-2-ylmethyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57130518) has the molecular formula C32H44N2O7 and a molecular weight of 568.71 g/mol. Its IUPAC name is 3-[2-[[1-(furan-2-ylmethyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-[[1-(furan-2-ylmethyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57130518 |
| Molecular Formula | C32H44N2O7 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 3-[2-[[1-(furan-2-ylmethyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CC1(C)OCC(C)(C)C(C(=O)c2cc[nH]c2C(CC(=O)O)C2CCCCC2NC(=O)C2(Cc3ccco3)CCC2)O1 |
| InChI | InChI=1S/C32H44N2O7/c1-30(2)19-40-31(3,4)41-28(30)27(37)22-12-15-33-26(22)23(17-25(35)36)21-10-5-6-11-24(21)34-29(38)32(13-8-14-32)18-20-9-7-16-39-20/h7,9,12,15-16,21,23-24,28,33H,5-6,8,10-11,13-14,17-19H2,1-4H3,(H,34,38)(H,35,36) |
| InChIKey | WOWXFEAEVNIZSM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |