C36H53N3O6 — CID 57159334
3-[2-[[benzyl(hexyl)carbamoyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57159334) has the molecular formula C36H53N3O6 and a molecular weight of 623.84 g/mol. Its IUPAC name is 3-[2-[[benzyl(hexyl)carbamoyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-[[benzyl(hexyl)carbamoyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57159334 |
| Molecular Formula | C36H53N3O6 |
| Molecular Weight | 623.84 g/mol |
| Exact Mass | 623.39 |
| IUPAC Name | 3-[2-[[benzyl(hexyl)carbamoyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCCCN(Cc1ccccc1)C(=O)NC1CCCCC1C(CC(=O)O)c1[nH]ccc1C(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C36H53N3O6/c1-6-7-8-14-21-39(23-25-15-10-9-11-16-25)34(43)38-29-18-13-12-17-26(29)28(22-30(40)41)31-27(19-20-37-31)32(42)33-35(2,3)24-44-36(4,5)45-33/h9-11,15-16,19-20,26,28-29,33,37H,6-8,12-14,17-18,21-24H2,1-5H3,(H,38,43)(H,40,41) |
| InChIKey | BXLYTUQMJRILFJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.84 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|