C40H60N2O6 — CID 57162136
3-[3-(2-benzylundecanoylamino)cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57162136) has the molecular formula C40H60N2O6 and a molecular weight of 664.93 g/mol. Its IUPAC name is 3-[3-(2-benzylundecanoylamino)cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[3-(2-benzylundecanoylamino)cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57162136 |
| Molecular Formula | C40H60N2O6 |
| Molecular Weight | 664.93 g/mol |
| Exact Mass | 664.45 |
| IUPAC Name | 3-[3-(2-benzylundecanoylamino)cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CCCCCCCCCC(Cc1ccccc1)C(=O)NC1CCCC(C(CC(=O)O)c2[nH]ccc2C(=O)C2OC(C)(C)OCC2(C)C)C1 |
| InChI | InChI=1S/C40H60N2O6/c1-6-7-8-9-10-11-15-19-30(24-28-17-13-12-14-18-28)38(46)42-31-21-16-20-29(25-31)33(26-34(43)44)35-32(22-23-41-35)36(45)37-39(2,3)27-47-40(4,5)48-37/h12-14,17-18,22-23,29-31,33,37,41H,6-11,15-16,19-21,24-27H2,1-5H3,(H,42,46)(H,43,44) |
| InChIKey | TWUINVZRWVNFAM-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.93 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|