C35H52N2O6 — CID 139818276
[1-(2-benzylundecanoyl)-2H-pyridin-4-yl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 139818276) has the molecular formula C35H52N2O6 and a molecular weight of 596.81 g/mol. Its IUPAC name is [1-(2-benzylundecanoyl)-2H-pyridin-4-yl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [1-(2-benzylundecanoyl)-2H-pyridin-4-yl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 139818276 |
| Molecular Formula | C35H52N2O6 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.38 |
| IUPAC Name | [1-(2-benzylundecanoyl)-2H-pyridin-4-yl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCCCC(Cc1ccccc1)C(=O)N1C=CC(OC(=O)CCNC(=O)C2OC(C)(C)OCC2(C)C)=CC1 |
| InChI | InChI=1S/C35H52N2O6/c1-6-7-8-9-10-11-15-18-28(25-27-16-13-12-14-17-27)33(40)37-23-20-29(21-24-37)42-30(38)19-22-36-32(39)31-34(2,3)26-41-35(4,5)43-31/h12-14,16-17,20-21,23,28,31H,6-11,15,18-19,22,24-26H2,1-5H3,(H,36,39) |
| InChIKey | CZBHXCUBVIOLCO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|