C28H52N2O6 — CID 23174353
3-(2-tert-butylnonanoylamino)propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 23174353) has the molecular formula C28H52N2O6 and a molecular weight of 512.73 g/mol. Its IUPAC name is 3-(2-tert-butylnonanoylamino)propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | 3-(2-tert-butylnonanoylamino)propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 23174353 |
| Molecular Formula | C28H52N2O6 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.38 |
| IUPAC Name | 3-(2-tert-butylnonanoylamino)propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCC(C(=O)NCCCOC(=O)CCNC(=O)C1OC(C)(C)OCC1(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H52N2O6/c1-9-10-11-12-13-15-21(26(2,3)4)24(32)29-17-14-19-34-22(31)16-18-30-25(33)23-27(5,6)20-35-28(7,8)36-23/h21,23H,9-20H2,1-8H3,(H,29,32)(H,30,33) |
| InChIKey | VIEMBEIVRLXFAY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|