C28H50N2O6 — CID 19893739
3-(2,2-dimethylundec-10-enoylamino)propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 19893739) has the molecular formula C28H50N2O6 and a molecular weight of 510.72 g/mol. Its IUPAC name is 3-(2,2-dimethylundec-10-enoylamino)propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | 3-(2,2-dimethylundec-10-enoylamino)propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 19893739 |
| Molecular Formula | C28H50N2O6 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | 3-(2,2-dimethylundec-10-enoylamino)propyl 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | C=CCCCCCCCC(C)(C)C(=O)NCCCOC(=O)CCNC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C28H50N2O6/c1-8-9-10-11-12-13-14-17-26(2,3)25(33)30-18-15-20-34-22(31)16-19-29-24(32)23-27(4,5)21-35-28(6,7)36-23/h8,23H,1,9-21H2,2-7H3,(H,29,32)(H,30,33) |
| InChIKey | WDHDWIBCROVCAK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|