C33H61N3O6 — CID 102145546
[2-[[2,2-dimethylpropyl(nonyl)carbamoyl]amino]cyclohexyl] (2S)-2-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 102145546) has the molecular formula C33H61N3O6 and a molecular weight of 595.87 g/mol. Its IUPAC name is [2-[[2,2-dimethylpropyl(nonyl)carbamoyl]amino]cyclohexyl] (2S)-2-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [2-[[2,2-dimethylpropyl(nonyl)carbamoyl]amino]cyclohexyl] (2S)-2-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 102145546 |
| Molecular Formula | C33H61N3O6 |
| Molecular Weight | 595.87 g/mol |
| Exact Mass | 595.46 |
| IUPAC Name | [2-[[2,2-dimethylpropyl(nonyl)carbamoyl]amino]cyclohexyl] (2S)-2-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCCCN(CC(C)(C)C)C(=O)NC1CCCCC1OC(=O)[C@H](C)NC(=O)C1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C33H61N3O6/c1-10-11-12-13-14-15-18-21-36(22-31(3,4)5)30(39)35-25-19-16-17-20-26(25)41-29(38)24(2)34-28(37)27-32(6,7)23-40-33(8,9)42-27/h24-27H,10-23H2,1-9H3,(H,34,37)(H,35,39)/t24-,25?,26?,27?/m0/s1 |
| InChIKey | HWZITYQFJVTVAA-IQSBJVTKSA-N |
| XLogP | 6.33 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.87 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|