C35H64N4O5 — CID 67939961
N-[3-[2-amino-1-(octadec-9-enoylamino)piperidin-3-yl]-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide (PubChem CID 67939961) has the molecular formula C35H64N4O5 and a molecular weight of 620.92 g/mol. Its IUPAC name is N-[3-[2-amino-1-(octadec-9-enoylamino)piperidin-3-yl]-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide.
| Compound Name | N-[3-[2-amino-1-(octadec-9-enoylamino)piperidin-3-yl]-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide |
|---|---|
| PubChem CID | 67939961 |
| Molecular Formula | C35H64N4O5 |
| Molecular Weight | 620.92 g/mol |
| Exact Mass | 620.49 |
| IUPAC Name | N-[3-[2-amino-1-(octadec-9-enoylamino)piperidin-3-yl]-3-oxopropyl]-2,2,5,5-tetramethyl-1,3-dioxane-4-carboxamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NN1CCCC(C(=O)CCNC(=O)C2OC(C)(C)OCC2(C)C)C1N |
| InChI | InChI=1S/C35H64N4O5/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-30(41)38-39-26-21-22-28(32(39)36)29(40)24-25-37-33(42)31-34(2,3)27-43-35(4,5)44-31/h13-14,28,31-32H,6-12,15-27,36H2,1-5H3,(H,37,42)(H,38,41) |
| InChIKey | XSRDQRQBWWIPEF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|