C37H58N2O8 — CID 67916220
(2S)-3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]-2-[4-[[(Z)-octadec-9-enoyl]amino]phenyl]propanoic acid (PubChem CID 67916220) has the molecular formula C37H58N2O8 and a molecular weight of 658.88 g/mol. Its IUPAC name is (2S)-3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]-2-[4-[[(Z)-octadec-9-enoyl]amino]phenyl]propanoic acid.
| Compound Name | (2S)-3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]-2-[4-[[(Z)-octadec-9-enoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67916220 |
| Molecular Formula | C37H58N2O8 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.42 |
| IUPAC Name | (2S)-3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]-2-[4-[[(Z)-octadec-9-enoyl]amino]phenyl]propanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Nc1ccc([C@@H](CNC(=O)C(OC(C)=O)C(C)(C)COC(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C37H58N2O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-33(42)39-31-24-22-30(23-25-31)32(36(44)45)26-38-35(43)34(47-29(3)41)37(4,5)27-46-28(2)40/h13-14,22-25,32,34H,6-12,15-21,26-27H2,1-5H3,(H,38,43)(H,39,42)(H,44,45)/b14-13-/t32-,34?/m1/s1 |
| InChIKey | DZTWFXOEIYEOJU-ZPTZUBLGSA-N |
| XLogP | 7.47 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|