C34H60N2O8 — CID 54403873
3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]-6-(octadec-9-enoylamino)hexanoic acid (PubChem CID 54403873) has the molecular formula C34H60N2O8 and a molecular weight of 624.86 g/mol. Its IUPAC name is 3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]-6-(octadec-9-enoylamino)hexanoic acid.
| Compound Name | 3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]-6-(octadec-9-enoylamino)hexanoic acid |
|---|---|
| PubChem CID | 54403873 |
| Molecular Formula | C34H60N2O8 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.43 |
| IUPAC Name | 3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]-6-(octadec-9-enoylamino)hexanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCCC(CC(=O)O)NC(=O)C(OC(C)=O)C(C)(C)COC(C)=O |
| InChI | InChI=1S/C34H60N2O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-30(39)35-24-21-22-29(25-31(40)41)36-33(42)32(44-28(3)38)34(4,5)26-43-27(2)37/h13-14,29,32H,6-12,15-26H2,1-5H3,(H,35,39)(H,36,42)(H,40,41) |
| InChIKey | VPHQJVGWWVOBKZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|