C35H64N2O7 — CID 173345461
2-[[[4-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]methyl]-5-(octadec-9-enoylamino)pentanoic acid (PubChem CID 173345461) has the molecular formula C35H64N2O7 and a molecular weight of 624.90 g/mol. Its IUPAC name is 2-[[[4-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]methyl]-5-(octadec-9-enoylamino)pentanoic acid.
| Compound Name | 2-[[[4-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]methyl]-5-(octadec-9-enoylamino)pentanoic acid |
|---|---|
| PubChem CID | 173345461 |
| Molecular Formula | C35H64N2O7 |
| Molecular Weight | 624.90 g/mol |
| Exact Mass | 624.47 |
| IUPAC Name | 2-[[[4-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethylbutanoyl]amino]methyl]-5-(octadec-9-enoylamino)pentanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCCC(CNC(=O)C(O)C(C)(C)COC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C35H64N2O7/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-29(38)36-25-22-23-28(32(41)42)26-37-31(40)30(39)35(5,6)27-44-33(43)34(2,3)4/h14-15,28,30,39H,7-13,16-27H2,1-6H3,(H,36,38)(H,37,40)(H,41,42) |
| InChIKey | FNCOBRFWBJVNBA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.90 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|