C37H59N3O7 — CID 67795143
[3-acetyloxy-2,2-dimethyl-4-[[3-[3-[[(Z)-octadec-9-enoyl]amino]anilino]-3-oxopropyl]amino]-4-oxobutyl] acetate (PubChem CID 67795143) has the molecular formula C37H59N3O7 and a molecular weight of 657.89 g/mol. Its IUPAC name is [3-acetyloxy-2,2-dimethyl-4-[[3-[3-[[(Z)-octadec-9-enoyl]amino]anilino]-3-oxopropyl]amino]-4-oxobutyl] acetate.
| Compound Name | [3-acetyloxy-2,2-dimethyl-4-[[3-[3-[[(Z)-octadec-9-enoyl]amino]anilino]-3-oxopropyl]amino]-4-oxobutyl] acetate |
|---|---|
| PubChem CID | 67795143 |
| Molecular Formula | C37H59N3O7 |
| Molecular Weight | 657.89 g/mol |
| Exact Mass | 657.44 |
| IUPAC Name | [3-acetyloxy-2,2-dimethyl-4-[[3-[3-[[(Z)-octadec-9-enoyl]amino]anilino]-3-oxopropyl]amino]-4-oxobutyl] acetate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Nc1cccc(NC(=O)CCNC(=O)C(OC(C)=O)C(C)(C)COC(C)=O)c1 |
| InChI | InChI=1S/C37H59N3O7/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-33(43)39-31-22-21-23-32(27-31)40-34(44)25-26-38-36(45)35(47-30(3)42)37(4,5)28-46-29(2)41/h13-14,21-23,27,35H,6-12,15-20,24-26,28H2,1-5H3,(H,38,45)(H,39,43)(H,40,44)/b14-13- |
| InChIKey | IESPQODPVSBXBW-YPKPFQOOSA-N |
| XLogP | 7.63 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.89 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|