C27H41N3O8S — CID 155145205
(2R)-3-amino-2-[4-(phenylmethoxycarbonylamino)butanoylsulfanylmethyl]-5-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]pentanoic acid (PubChem CID 155145205) has the molecular formula C27H41N3O8S and a molecular weight of 567.71 g/mol. Its IUPAC name is (2R)-3-amino-2-[4-(phenylmethoxycarbonylamino)butanoylsulfanylmethyl]-5-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2R)-3-amino-2-[4-(phenylmethoxycarbonylamino)butanoylsulfanylmethyl]-5-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 155145205 |
| Molecular Formula | C27H41N3O8S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | (2R)-3-amino-2-[4-(phenylmethoxycarbonylamino)butanoylsulfanylmethyl]-5-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]pentanoic acid |
| SMILES | CC1(C)OCC(C)(C)[C@H](C(=O)NCCC(N)[C@@H](CSC(=O)CCCNC(=O)OCc2ccccc2)C(=O)O)O1 |
| InChI | InChI=1S/C27H41N3O8S/c1-26(2)17-37-27(3,4)38-22(26)23(32)29-14-12-20(28)19(24(33)34)16-39-21(31)11-8-13-30-25(35)36-15-18-9-6-5-7-10-18/h5-7,9-10,19-20,22H,8,11-17,28H2,1-4H3,(H,29,32)(H,30,35)(H,33,34)/t19-,20?,22+/m1/s1 |
| InChIKey | YKTTZWFSAITZHT-OBIJOXKXSA-N |
| XLogP | 2.66 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|