C21H36N2O8S — CID 155145327
(2R)-2-(4-acetyloxybutanoylsulfanylmethyl)-3-amino-5-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]pentanoic acid (PubChem CID 155145327) has the molecular formula C21H36N2O8S and a molecular weight of 476.59 g/mol. Its IUPAC name is (2R)-2-(4-acetyloxybutanoylsulfanylmethyl)-3-amino-5-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2R)-2-(4-acetyloxybutanoylsulfanylmethyl)-3-amino-5-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 155145327 |
| Molecular Formula | C21H36N2O8S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (2R)-2-(4-acetyloxybutanoylsulfanylmethyl)-3-amino-5-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]pentanoic acid |
| SMILES | CC(=O)OCCCC(=O)SC[C@@H](C(=O)O)C(N)CCNC(=O)[C@@H]1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C21H36N2O8S/c1-13(24)29-10-6-7-16(25)32-11-14(19(27)28)15(22)8-9-23-18(26)17-20(2,3)12-30-21(4,5)31-17/h14-15,17H,6-12,22H2,1-5H3,(H,23,26)(H,27,28)/t14-,15?,17+/m1/s1 |
| InChIKey | SNGOOSFAUNNREO-BZEOVNSFSA-N |
| XLogP | 1.30 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|