C20H33N3O6S — CID 162512942
S-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]prop-2-enoylamino]ethyl] 4-acetamidobutanethioate (PubChem CID 162512942) has the molecular formula C20H33N3O6S and a molecular weight of 443.57 g/mol. Its IUPAC name is S-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]prop-2-enoylamino]ethyl] 4-acetamidobutanethioate.
| Compound Name | S-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]prop-2-enoylamino]ethyl] 4-acetamidobutanethioate |
|---|---|
| PubChem CID | 162512942 |
| Molecular Formula | C20H33N3O6S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | S-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]prop-2-enoylamino]ethyl] 4-acetamidobutanethioate |
| SMILES | CC(=O)NCCCC(=O)SCCNC(=O)C=CNC(=O)[C@@H]1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C20H33N3O6S/c1-14(24)21-9-6-7-16(26)30-12-11-22-15(25)8-10-23-18(27)17-19(2,3)13-28-20(4,5)29-17/h8,10,17H,6-7,9,11-13H2,1-5H3,(H,21,24)(H,22,25)(H,23,27)/t17-/m0/s1 |
| InChIKey | ZUPGHTQMKWSGOV-KRWDZBQOSA-N |
| XLogP | 1.09 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|