C26H50N2O7SSi — CID 164888882
S-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethyl] (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate (PubChem CID 164888882) has the molecular formula C26H50N2O7SSi and a molecular weight of 562.85 g/mol. Its IUPAC name is S-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethyl] (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate.
| Compound Name | S-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethyl] (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate |
|---|---|
| PubChem CID | 164888882 |
| Molecular Formula | C26H50N2O7SSi |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | S-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethyl] (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyhexanethioate |
| SMILES | C[C@H](C[C@H](O)CC(=O)SCCNC(=O)CCNC(=O)[C@@H]1OC(C)(C)OCC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50N2O7SSi/c1-18(35-37(9,10)24(2,3)4)15-19(29)16-21(31)36-14-13-27-20(30)11-12-28-23(32)22-25(5,6)17-33-26(7,8)34-22/h18-19,22,29H,11-17H2,1-10H3,(H,27,30)(H,28,32)/t18-,19+,22+/m1/s1 |
| InChIKey | KUUHXTGJFSCOPE-DXIQSLLYSA-N |
| XLogP | 3.60 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|