C25H42N2O9S — CID 151655517
3-[5,5-dimethyl-2-[2-oxo-2-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]ethyl]-1,3-dioxan-2-yl]propanoic acid (PubChem CID 151655517) has the molecular formula C25H42N2O9S and a molecular weight of 546.68 g/mol. Its IUPAC name is 3-[5,5-dimethyl-2-[2-oxo-2-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]ethyl]-1,3-dioxan-2-yl]propanoic acid.
| Compound Name | 3-[5,5-dimethyl-2-[2-oxo-2-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]ethyl]-1,3-dioxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 151655517 |
| Molecular Formula | C25H42N2O9S |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 3-[5,5-dimethyl-2-[2-oxo-2-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]ethyl]-1,3-dioxan-2-yl]propanoic acid |
| SMILES | CC1(C)COC(CCC(=O)O)(CC(=O)SCCNC(=O)CCNC(=O)[C@@H]2OC(C)(C)OCC2(C)C)OC1 |
| InChI | InChI=1S/C25H42N2O9S/c1-22(2)14-34-25(35-15-22,9-7-18(29)30)13-19(31)37-12-11-26-17(28)8-10-27-21(32)20-23(3,4)16-33-24(5,6)36-20/h20H,7-16H2,1-6H3,(H,26,28)(H,27,32)(H,29,30)/t20-/m0/s1 |
| InChIKey | QVKJASVIERCEQX-FQEVSTJZSA-N |
| XLogP | 2.07 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|