C18H32N3O8PS — CID 146225969
2-[[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]amino]-3-methylbutanoic acid (PubChem CID 146225969) has the molecular formula C18H32N3O8PS and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 146225969 |
| Molecular Formula | C18H32N3O8PS |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[[(2R,4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]amino]-3-methylbutanoic acid |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@@H]1O[P@@](=O)(NC(C(=O)O)C(C)C)OCC1(C)C |
| InChI | InChI=1S/C18H32N3O8PS/c1-11(2)14(17(25)26)21-30(27)28-10-18(4,5)15(29-30)16(24)20-7-6-13(23)19-8-9-31-12(3)22/h11,14-15H,6-10H2,1-5H3,(H,19,23)(H,20,24)(H,21,27)(H,25,26)/t14?,15-,30+/m0/s1 |
| InChIKey | GSYQAKVCWLYSAB-LQJVFZQPSA-N |
| XLogP | 1.14 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|